| Name | (2-Benzyloxyphenyl)boronic acid |
| Synonyms | AKOS BRN-0079 RARECHEM AH PB 0042 2-Benzyloxyphenylboronic acid O-BENZYLOXYPHENYLBORONIC ACID 2-BENZYLOXYPHENYLBORONIC ACID 2-Benzyloxybenzeneboronic acid 2-BENZYLOXYBENZENEBORONIC ACID 2-BENZYLOXYPHENYLBORORNIC ACID (2-Benzyloxyphenyl)boronic acid 2-Phenylmethoxy Phenylboronic Acid 2-Benzyloxyphenylboronic Acid (contains varying amounts of Anhydride) |
| CAS | 190661-29-1 |
| InChI | InChI=1/C13H13BO3/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9,15-16H,10H2 |
| Molecular Formula | C13H13BO3 |
| Molar Mass | 228.05 |
| Density | 1.20±0.1 g/cm3(Predicted) |
| Melting Point | 105-110°C(lit.) |
| Boling Point | 428.7±47.0 °C(Predicted) |
| Flash Point | 213°C |
| Solubility | Dichloromethane, Ethyl Acetate, Methanol |
| Vapor Presure | 4.13E-08mmHg at 25°C |
| Appearance | Solid |
| Color | White |
| BRN | 7813704 |
| pKa | 8.57±0.53(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.593 |
| MDL | MFCD01632206 |
| Use | This product is for scientific research only and shall not be used for other purposes. |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Hazard Note | Corrosive |
| Hazard Class | IRRITANT, CORROSIVE |